C27H28FN3O8 — CID 146522081
(2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 146522081) has the molecular formula C27H28FN3O8 and a molecular weight of 541.53 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146522081 |
| Molecular Formula | C27H28FN3O8 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)c1c(CCC(=O)OC2O[C@@H](C(=O)O)[C@H](O)[C@@H](O)[C@@H]2O)c2cc3[nH]ncc3cc2n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN3O8/c1-12(2)21-16(7-8-20(32)38-27-24(35)22(33)23(34)25(39-27)26(36)37)17-10-18-13(11-29-30-18)9-19(17)31(21)15-5-3-14(28)4-6-15/h3-6,9-12,22-25,27,33-35H,7-8H2,1-2H3,(H,29,30)(H,36,37)/t22-,23-,24+,25-,27?/m1/s1 |
| InChIKey | QUYVLDAAUKZWRL-MLGNGNQOSA-N |
| XLogP | 2.14 |
| TPSA | 167.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |