About 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole
5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole (PubChem CID 146522167) has the molecular formula C26H28FN3O2
and a molecular weight of 433.53 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole |
| PubChem CID | 146522167 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole |
| SMILES | Fc1ccc(-n2c(C3CCOCC3)c(CC3CCOCC3)c3cc4[nH]ncc4cc32)cc1 |
| InChI | InChI=1S/C26H28FN3O2/c27-20-1-3-21(4-2-20)30-25-14-19-16-28-29-24(19)15-22(25)23(13-17-5-9-31-10-6-17)26(30)18-7-11-32-12-8-18/h1-4,14-18H,5-13H2,(H,28,29) |
| InChIKey | BHQOJBJFDUBZFW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
The IUPAC name of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole (CID 146522167) is 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole.
What is the SMILES notation for 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
The canonical SMILES for 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole is Fc1ccc(-n2c(C3CCOCC3)c(CC3CCOCC3)c3cc4[nH]ncc4cc32)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
The InChIKey is BHQOJBJFDUBZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28FN3O2/c27-20-1-3-21(4-2-20)30-25-14-19-16-28-29-24(19)15-22(25)23(13-17-5-9-31-10-6-17)26(30)18-7-11-32-12-8-18/h1-4,14-18H,5-13H2,(H,28,29).
What are the key properties of 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole?
5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole has a molecular weight of 433.53 g/mol, XLogP of 5.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-6-(oxan-4-yl)-7-(oxan-4-ylmethyl)-1H-pyrrolo[2,3-f]indazole is sourced from PubChem (CID 146522167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).