About 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole
8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole (PubChem CID 146522313) has the molecular formula C25H25F2N3O2
and a molecular weight of 437.49 g/mol. Its IUPAC name is 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole.
Molecular Properties
| Compound Name | 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole |
| PubChem CID | 146522313 |
| Molecular Formula | C25H25F2N3O2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole |
| SMILES | Fc1ccc(-n2c(C3CCOCC3)cc3c(F)c4nn(C5CCCCO5)cc4cc32)cc1 |
| InChI | InChI=1S/C25H25F2N3O2/c26-18-4-6-19(7-5-18)30-21(16-8-11-31-12-9-16)14-20-22(30)13-17-15-29(28-25(17)24(20)27)23-3-1-2-10-32-23/h4-7,13-16,23H,1-3,8-12H2 |
| InChIKey | AACWJEBYMNOLAS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole?
The IUPAC name of 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole (CID 146522313) is 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole.
What is the SMILES notation for 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole?
The canonical SMILES for 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole is Fc1ccc(-n2c(C3CCOCC3)cc3c(F)c4nn(C5CCCCO5)cc4cc32)cc1.
What is the InChIKey of 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole?
The InChIKey is AACWJEBYMNOLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F2N3O2/c26-18-4-6-19(7-5-18)30-21(16-8-11-31-12-9-16)14-20-22(30)13-17-15-29(28-25(17)24(20)27)23-3-1-2-10-32-23/h4-7,13-16,23H,1-3,8-12H2.
What are the key properties of 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole?
8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole has a molecular weight of 437.49 g/mol, XLogP of 5.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-(4-fluorophenyl)-2-(oxan-2-yl)-6-(oxan-4-yl)pyrrolo[2,3-f]indazole is sourced from PubChem (CID 146522313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).