C13H20N2 — CID 146522400
(2Z,5Z,7Z)-1-imino-N,N-dimethyl-4-methylidenedeca-2,5,7-trien-3-amine (PubChem CID 146522400) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2Z,5Z,7Z)-1-imino-N,N-dimethyl-4-methylidenedeca-2,5,7-trien-3-amine.
| Compound Name | (2Z,5Z,7Z)-1-imino-N,N-dimethyl-4-methylidenedeca-2,5,7-trien-3-amine |
|---|---|
| PubChem CID | 146522400 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2Z,5Z,7Z)-1-imino-N,N-dimethyl-4-methylidenedeca-2,5,7-trien-3-amine |
| SMILES | [H]/N=C/C=C(\C(=C)/C=C\C=C/CC)N(C)C |
| InChI | InChI=1S/C13H20N2/c1-5-6-7-8-9-12(2)13(10-11-14)15(3)4/h6-11,14H,2,5H2,1,3-4H3/b7-6-,9-8-,13-10-,14-11+ |
| InChIKey | UJDSSIJQSOAAFS-UHSNALGHSA-N |
| XLogP | 3.16 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|