C45H36N4 — CID 146522545
9-[4-[(1S)-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]cyclohexyl]phenyl]carbazole (PubChem CID 146522545) has the molecular formula C45H36N4 and a molecular weight of 632.81 g/mol. Its IUPAC name is 9-[4-[(1S)-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]cyclohexyl]phenyl]carbazole.
| Compound Name | 9-[4-[(1S)-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]cyclohexyl]phenyl]carbazole |
|---|---|
| PubChem CID | 146522545 |
| Molecular Formula | C45H36N4 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 9-[4-[(1S)-2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]cyclohexyl]phenyl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(C4CCCC[C@@H]4c4ccc(-n5c6ccccc6c6ccccc65)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C45H36N4/c1-3-13-33(14-4-1)43-46-44(34-15-5-2-6-16-34)48-45(47-43)35-25-23-31(24-26-35)37-17-7-8-18-38(37)32-27-29-36(30-28-32)49-41-21-11-9-19-39(41)40-20-10-12-22-42(40)49/h1-6,9-16,19-30,37-38H,7-8,17-18H2/t37?,38-/m1/s1 |
| InChIKey | DVWUFCKDQKCHDE-YWIOZPJLSA-N |
| XLogP | 11.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |