C23H23NO2 — CID 146522722
1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-methylheptane-1,4-dione (PubChem CID 146522722) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-methylheptane-1,4-dione.
| Compound Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-methylheptane-1,4-dione |
|---|---|
| PubChem CID | 146522722 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-methylheptane-1,4-dione |
| SMILES | CCC(C)C(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C23H23NO2/c1-3-17(2)22(25)14-15-23(26)24-16-20-10-5-4-8-18(20)12-13-19-9-6-7-11-21(19)24/h4-11,17H,3,14-16H2,1-2H3 |
| InChIKey | NOTIEYOLCWVBHY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|