C30H32FN3O8 — CID 146522762
prop-2-enyl (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 146522762) has the molecular formula C30H32FN3O8 and a molecular weight of 581.60 g/mol. Its IUPAC name is prop-2-enyl (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | prop-2-enyl (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 146522762 |
| Molecular Formula | C30H32FN3O8 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | prop-2-enyl (2R,3R,4R,5S)-6-[3-[5-(4-fluorophenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1OC(OC(=O)CCc2c(C(C)C)n(-c3ccc(F)cc3)c3cc4cn[nH]c4cc23)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H32FN3O8/c1-4-11-40-29(39)28-26(37)25(36)27(38)30(42-28)41-23(35)10-9-19-20-13-21-16(14-32-33-21)12-22(20)34(24(19)15(2)3)18-7-5-17(31)6-8-18/h4-8,12-15,25-28,30,36-38H,1,9-11H2,2-3H3,(H,32,33)/t25-,26-,27+,28-,30?/m1/s1 |
| InChIKey | NJURMCQCBYPHDB-VAUJRCAMSA-N |
| XLogP | 2.78 |
| TPSA | 156.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|