C19H27N — CID 146522821
(2Z,3E)-2,3-bis(4,4-dimethylpent-1-en-3-ylidene)pyridine (PubChem CID 146522821) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (2Z,3E)-2,3-bis(4,4-dimethylpent-1-en-3-ylidene)pyridine.
| Compound Name | (2Z,3E)-2,3-bis(4,4-dimethylpent-1-en-3-ylidene)pyridine |
|---|---|
| PubChem CID | 146522821 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (2Z,3E)-2,3-bis(4,4-dimethylpent-1-en-3-ylidene)pyridine |
| SMILES | C=C/C(=c1/nccc/c1=C(/C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H27N/c1-9-15(18(3,4)5)14-12-11-13-20-17(14)16(10-2)19(6,7)8/h9-13H,1-2H2,3-8H3/b15-14+,17-16- |
| InChIKey | SOZLSOYAQRRTHA-FZIQOSRTSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |