C23H14F3N5O — CID 146522907
7-(2-imidazo[1,2-a]pyrazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 146522907) has the molecular formula C23H14F3N5O and a molecular weight of 433.39 g/mol. Its IUPAC name is 7-(2-imidazo[1,2-a]pyrazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-(2-imidazo[1,2-a]pyrazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146522907 |
| Molecular Formula | C23H14F3N5O |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 7-(2-imidazo[1,2-a]pyrazin-3-ylethynyl)-6-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | Cc1ccc2c(Nc3cccc(C(F)(F)F)c3)noc2c1C#Cc1cnc2cnccn12 |
| InChI | InChI=1S/C23H14F3N5O/c1-14-5-7-19-21(18(14)8-6-17-12-28-20-13-27-9-10-31(17)20)32-30-22(19)29-16-4-2-3-15(11-16)23(24,25)26/h2-5,7,9-13H,1H3,(H,29,30) |
| InChIKey | UIPBMASPKPGBHB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|