C28H16F3N5O — CID 146522908
7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-phenyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine (PubChem CID 146522908) has the molecular formula C28H16F3N5O and a molecular weight of 495.46 g/mol. Its IUPAC name is 7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-phenyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine.
| Compound Name | 7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-phenyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146522908 |
| Molecular Formula | C28H16F3N5O |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 7-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-6-phenyl-N-[3-(trifluoromethyl)phenyl]-1,2-benzoxazol-3-amine |
| SMILES | FC(F)(F)c1cccc(Nc2noc3c(C#Cc4cnc5cccnn45)c(-c4ccccc4)ccc23)c1 |
| InChI | InChI=1S/C28H16F3N5O/c29-28(30,31)19-8-4-9-20(16-19)34-27-24-14-13-22(18-6-2-1-3-7-18)23(26(24)37-35-27)12-11-21-17-32-25-10-5-15-33-36(21)25/h1-10,13-17H,(H,34,35) |
| InChIKey | ZDHUAATZCHEINL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|