C81H66N2O — CID 146523096
5-N,5-N,9-N,9-N-tetrakis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran-5,9-diamine (PubChem CID 146523096) has the molecular formula C81H66N2O and a molecular weight of 1083.43 g/mol. Its IUPAC name is 5-N,5-N,9-N,9-N-tetrakis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran-5,9-diamine.
| Compound Name | 5-N,5-N,9-N,9-N-tetrakis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran-5,9-diamine |
|---|---|
| PubChem CID | 146523096 |
| Molecular Formula | C81H66N2O |
| Molecular Weight | 1083.43 g/mol |
| Exact Mass | 1082.52 |
| IUPAC Name | 5-N,5-N,9-N,9-N-tetrakis(9,9-dimethylfluoren-2-yl)-7,7-dimethylfluoreno[4,3-b][1]benzofuran-5,9-diamine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4c(c3)C(C)(C)c3cc(N(c5ccc6c(c5)C(C)(C)c5ccccc5-6)c5ccc6c(c5)C(C)(C)c5ccccc5-6)c5c(oc6ccccc65)c3-4)cc21 |
| InChI | InChI=1S/C81H66N2O/c1-77(2)62-26-16-11-21-52(62)56-36-31-47(41-66(56)77)82(48-32-37-57-53-22-12-17-27-63(53)78(3,4)67(57)42-48)49-35-40-60-70(43-49)81(9,10)71-46-72(75-61-25-15-20-30-73(61)84-76(75)74(60)71)83(50-33-38-58-54-23-13-18-28-64(54)79(5,6)68(58)44-50)51-34-39-59-55-24-14-19-29-65(55)80(7,8)69(59)45-51/h11-46H,1-10H3 |
| InChIKey | OQFRJJXJNZVMGL-UHFFFAOYSA-N |
| XLogP | 22.06 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.43 |
| LogP ≤ 5 | 22.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |