About [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane
[1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane (PubChem CID 14652367) has the molecular formula C18H26OS2Si
and a molecular weight of 350.62 g/mol. Its IUPAC name is [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane |
| PubChem CID | 14652367 |
| Molecular Formula | C18H26OS2Si |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane |
| SMILES | C#CCCC(O[Si](C)(C)C)(c1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C18H26OS2Si/c1-5-6-13-18(19-22(2,3)4,16-11-8-7-9-12-16)17-20-14-10-15-21-17/h1,7-9,11-12,17H,6,10,13-15H2,2-4H3 |
| InChIKey | NDURRIHGRYAUIW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane?
The IUPAC name of [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane (CID 14652367) is [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane.
What is the SMILES notation for [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane?
The canonical SMILES for [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane is C#CCCC(O[Si](C)(C)C)(c1ccccc1)C1SCCCS1.
What is the InChIKey of [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane?
The InChIKey is NDURRIHGRYAUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26OS2Si/c1-5-6-13-18(19-22(2,3)4,16-11-8-7-9-12-16)17-20-14-10-15-21-17/h1,7-9,11-12,17H,6,10,13-15H2,2-4H3.
What are the key properties of [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane?
[1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane has a molecular weight of 350.62 g/mol, XLogP of 5.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-dithian-2-yl)-1-phenylpent-4-ynoxy]-trimethylsilane is sourced from PubChem (CID 14652367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).