C24H25FN6OS — CID 146523909
5-ethylsulfanyl-4-[[4-(3-fluoro-2-pyridinyl)phenyl]methyl]-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 146523909) has the molecular formula C24H25FN6OS and a molecular weight of 464.57 g/mol. Its IUPAC name is 5-ethylsulfanyl-4-[[4-(3-fluoro-2-pyridinyl)phenyl]methyl]-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | 5-ethylsulfanyl-4-[[4-(3-fluoro-2-pyridinyl)phenyl]methyl]-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 146523909 |
| Molecular Formula | C24H25FN6OS |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 5-ethylsulfanyl-4-[[4-(3-fluoro-2-pyridinyl)phenyl]methyl]-8,11,11-trimethyl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CCSc1c2c(nn1Cc1ccc(-c3ncccc3F)cc1)N1CC(C)(C)N=C1N(C)C2=O |
| InChI | InChI=1S/C24H25FN6OS/c1-5-33-22-18-20(30-14-24(2,3)27-23(30)29(4)21(18)32)28-31(22)13-15-8-10-16(11-9-15)19-17(25)7-6-12-26-19/h6-12H,5,13-14H2,1-4H3 |
| InChIKey | QUBLXJZUJNNSTA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |