C18H9F5N2O2 — CID 146523980
5-(3-cyano-5-fluorophenoxy)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylindene-4-carbonitrile (PubChem CID 146523980) has the molecular formula C18H9F5N2O2 and a molecular weight of 380.27 g/mol. Its IUPAC name is 5-(3-cyano-5-fluorophenoxy)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylindene-4-carbonitrile.
| Compound Name | 5-(3-cyano-5-fluorophenoxy)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylindene-4-carbonitrile |
|---|---|
| PubChem CID | 146523980 |
| Molecular Formula | C18H9F5N2O2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-(3-cyano-5-fluorophenoxy)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylindene-4-carbonitrile |
| SMILES | CC1(O)c2c(ccc(Oc3cc(F)cc(C#N)c3)c2C#N)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H9F5N2O2/c1-16(26)15-12(8-25)14(3-2-13(15)17(20,21)18(16,22)23)27-11-5-9(7-24)4-10(19)6-11/h2-6,26H,1H3 |
| InChIKey | QNLOZMOQNIVKJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|