About 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one
5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one (PubChem CID 146524270) has the molecular formula C19H18N2O3S
and a molecular weight of 354.43 g/mol. Its IUPAC name is 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one |
| PubChem CID | 146524270 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one |
| SMILES | CCc1cccc2c1CCN2S(=O)(=O)c1cccc2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C19H18N2O3S/c1-2-13-5-3-7-17-14(13)10-12-21(17)25(23,24)18-8-4-6-16-15(18)9-11-20-19(16)22/h3-9,11H,2,10,12H2,1H3,(H,20,22) |
| InChIKey | CWROKKPJTUFBTO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one?
The IUPAC name of 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one (CID 146524270) is 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one.
What is the SMILES notation for 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one?
The canonical SMILES for 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one is CCc1cccc2c1CCN2S(=O)(=O)c1cccc2c(=O)[nH]ccc12.
What is the InChIKey of 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one?
The InChIKey is CWROKKPJTUFBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3S/c1-2-13-5-3-7-17-14(13)10-12-21(17)25(23,24)18-8-4-6-16-15(18)9-11-20-19(16)22/h3-9,11H,2,10,12H2,1H3,(H,20,22).
What are the key properties of 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one?
5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one has a molecular weight of 354.43 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-ethyl-2,3-dihydroindol-1-yl)sulfonyl]-2H-isoquinolin-1-one is sourced from PubChem (CID 146524270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).