C13H16N2O2 — CID 146524351
(2'R,3S)-6-amino-2'-methylspiro[1H-indole-3,4'-oxane]-2-one (PubChem CID 146524351) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2'R,3S)-6-amino-2'-methylspiro[1H-indole-3,4'-oxane]-2-one.
| Compound Name | (2'R,3S)-6-amino-2'-methylspiro[1H-indole-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 146524351 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2'R,3S)-6-amino-2'-methylspiro[1H-indole-3,4'-oxane]-2-one |
| SMILES | C[C@@H]1C[C@]2(CCO1)C(=O)Nc1cc(N)ccc12 |
| InChI | InChI=1S/C13H16N2O2/c1-8-7-13(4-5-17-8)10-3-2-9(14)6-11(10)15-12(13)16/h2-3,6,8H,4-5,7,14H2,1H3,(H,15,16)/t8-,13+/m1/s1 |
| InChIKey | VXNMUMAATLPWDZ-OQPBUACISA-N |
| XLogP | 1.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|