C22H23FN4O4S — CID 146524816
4-amino-5-cyclopropyl-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide (PubChem CID 146524816) has the molecular formula C22H23FN4O4S and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-amino-5-cyclopropyl-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide.
| Compound Name | 4-amino-5-cyclopropyl-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 146524816 |
| Molecular Formula | C22H23FN4O4S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-amino-5-cyclopropyl-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-N-pyrimidin-4-ylbenzenesulfonamide |
| SMILES | COc1ccc(CN(c2ccncn2)S(=O)(=O)c2cc(C3CC3)c(N)cc2F)c(OC)c1 |
| InChI | InChI=1S/C22H23FN4O4S/c1-30-16-6-5-15(20(9-16)31-2)12-27(22-7-8-25-13-26-22)32(28,29)21-10-17(14-3-4-14)19(24)11-18(21)23/h5-11,13-14H,3-4,12,24H2,1-2H3 |
| InChIKey | BTMPWVLMLPDDOY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|