About tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate
tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate (PubChem CID 146525045) has the molecular formula C26H31N3O4
and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate |
| PubChem CID | 146525045 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate |
| SMILES | Cc1cccc(C)c1Oc1ccc(N)cc1-c1cc(N(C)C(=O)OC(C)(C)C)c(=O)n(C)c1 |
| InChI | InChI=1S/C26H31N3O4/c1-16-9-8-10-17(2)23(16)32-22-12-11-19(27)14-20(22)18-13-21(24(30)28(6)15-18)29(7)25(31)33-26(3,4)5/h8-15H,27H2,1-7H3 |
| InChIKey | QBXJGHCOIUEJJF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate (CID 146525045) is tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate is Cc1cccc(C)c1Oc1ccc(N)cc1-c1cc(N(C)C(=O)OC(C)(C)C)c(=O)n(C)c1.
What is the InChIKey of tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate?
The InChIKey is QBXJGHCOIUEJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N3O4/c1-16-9-8-10-17(2)23(16)32-22-12-11-19(27)14-20(22)18-13-21(24(30)28(6)15-18)29(7)25(31)33-26(3,4)5/h8-15H,27H2,1-7H3.
What are the key properties of tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate?
tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate has a molecular weight of 449.55 g/mol, XLogP of 5.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[5-amino-2-(2,6-dimethylphenoxy)phenyl]-1-methyl-2-oxo-3-pyridinyl]-N-methylcarbamate is sourced from PubChem (CID 146525045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).