C26H21F4N3O2 — CID 146525365
2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 146525365) has the molecular formula C26H21F4N3O2 and a molecular weight of 483.47 g/mol. Its IUPAC name is 2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146525365 |
| Molecular Formula | C26H21F4N3O2 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1nc2c(C(=O)O)cc(-c3c(F)c(F)c(-c4ccc(CN5CCCC5)cc4)c(F)c3F)cc2[nH]1 |
| InChI | InChI=1S/C26H21F4N3O2/c1-13-31-18-11-16(10-17(26(34)35)25(18)32-13)20-23(29)21(27)19(22(28)24(20)30)15-6-4-14(5-7-15)12-33-8-2-3-9-33/h4-7,10-11H,2-3,8-9,12H2,1H3,(H,31,32)(H,34,35) |
| InChIKey | ZDFNHPOTCYDHEA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|