C22H23F2N5O3S — CID 146525819
5-(2-cyclopropylethynyl)-2-(4,4-difluoropiperidin-1-yl)-6-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide (PubChem CID 146525819) has the molecular formula C22H23F2N5O3S and a molecular weight of 475.52 g/mol. Its IUPAC name is 5-(2-cyclopropylethynyl)-2-(4,4-difluoropiperidin-1-yl)-6-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 5-(2-cyclopropylethynyl)-2-(4,4-difluoropiperidin-1-yl)-6-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146525819 |
| Molecular Formula | C22H23F2N5O3S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 5-(2-cyclopropylethynyl)-2-(4,4-difluoropiperidin-1-yl)-6-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(N2CCC(F)(F)CC2)c(C(=O)Nc2ccnc(S(N)(=O)=O)c2)cc1C#CC1CC1 |
| InChI | InChI=1S/C22H23F2N5O3S/c1-14-16(5-4-15-2-3-15)12-18(20(27-14)29-10-7-22(23,24)8-11-29)21(30)28-17-6-9-26-19(13-17)33(25,31)32/h6,9,12-13,15H,2-3,7-8,10-11H2,1H3,(H2,25,31,32)(H,26,28,30) |
| InChIKey | UQGRTUXRGBIUNG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|