About 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide
5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide (PubChem CID 146525962) has the molecular formula C14H16F2N4O
and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide |
| PubChem CID | 146525962 |
| Molecular Formula | C14H16F2N4O |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide |
| SMILES | Cc1nc(N2CCCC(F)(F)CC2)c(C(N)=O)cc1C#N |
| InChI | InChI=1S/C14H16F2N4O/c1-9-10(8-17)7-11(12(18)21)13(19-9)20-5-2-3-14(15,16)4-6-20/h7H,2-6H2,1H3,(H2,18,21) |
| InChIKey | CUERWIYVNUCATA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide?
The IUPAC name of 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide (CID 146525962) is 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide.
What is the SMILES notation for 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide?
The canonical SMILES for 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide is Cc1nc(N2CCCC(F)(F)CC2)c(C(N)=O)cc1C#N.
What is the InChIKey of 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide?
The InChIKey is CUERWIYVNUCATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N4O/c1-9-10(8-17)7-11(12(18)21)13(19-9)20-5-2-3-14(15,16)4-6-20/h7H,2-6H2,1H3,(H2,18,21).
What are the key properties of 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide?
5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide has a molecular weight of 294.31 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-2-(4,4-difluoroazepan-1-yl)-6-methylpyridine-3-carboxamide is sourced from PubChem (CID 146525962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).