C16H12F7N5O3S — CID 146525976
N-(2-sulfamoyl-4-pyridinyl)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 146525976) has the molecular formula C16H12F7N5O3S and a molecular weight of 487.36 g/mol. Its IUPAC name is N-(2-sulfamoyl-4-pyridinyl)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(2-sulfamoyl-4-pyridinyl)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146525976 |
| Molecular Formula | C16H12F7N5O3S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | N-(2-sulfamoyl-4-pyridinyl)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)c2cc(C(F)(F)F)cnc2N2CC(F)(F)C(F)(F)C2)ccn1 |
| InChI | InChI=1S/C16H12F7N5O3S/c17-14(18)6-28(7-15(14,19)20)12-10(3-8(5-26-12)16(21,22)23)13(29)27-9-1-2-25-11(4-9)32(24,30)31/h1-5H,6-7H2,(H2,24,30,31)(H,25,27,29) |
| InChIKey | DKERTEFASSZOBN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|