About methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate
methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate (PubChem CID 146525996) has the molecular formula C17H22F2N2O2
and a molecular weight of 324.37 g/mol. Its IUPAC name is methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate |
| PubChem CID | 146525996 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C2CCC2)nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C17H22F2N2O2/c1-23-16(22)13-6-7-14(12-4-2-5-12)20-15(13)21-10-3-8-17(18,19)9-11-21/h6-7,12H,2-5,8-11H2,1H3 |
| InChIKey | FAZQNSGVYZQHNG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate?
The IUPAC name of methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate (CID 146525996) is methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate?
The canonical SMILES for methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate is COC(=O)c1ccc(C2CCC2)nc1N1CCCC(F)(F)CC1.
What is the InChIKey of methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate?
The InChIKey is FAZQNSGVYZQHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2N2O2/c1-23-16(22)13-6-7-14(12-4-2-5-12)20-15(13)21-10-3-8-17(18,19)9-11-21/h6-7,12H,2-5,8-11H2,1H3.
What are the key properties of methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate?
methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate has a molecular weight of 324.37 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-cyclobutyl-2-(4,4-difluoroazepan-1-yl)pyridine-3-carboxylate is sourced from PubChem (CID 146525996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).