C18H10F7NO2 — CID 146526399
3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl]oxy-5-fluorobenzonitrile (PubChem CID 146526399) has the molecular formula C18H10F7NO2 and a molecular weight of 405.27 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl]oxy-5-fluorobenzonitrile.
| Compound Name | 3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl]oxy-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 146526399 |
| Molecular Formula | C18H10F7NO2 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 3-[4-(difluoromethyl)-1,1,2,2-tetrafluoro-3-hydroxy-3-methylinden-5-yl]oxy-5-fluorobenzonitrile |
| SMILES | CC1(O)c2c(ccc(Oc3cc(F)cc(C#N)c3)c2C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H10F7NO2/c1-16(27)14-11(17(22,23)18(16,24)25)2-3-12(13(14)15(20)21)28-10-5-8(7-26)4-9(19)6-10/h2-6,15,27H,1H3 |
| InChIKey | MFQAVIDRUJBLAG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|