About [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate
[5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate (PubChem CID 146526462) has the molecular formula C12H10F2N2O4S
and a molecular weight of 316.29 g/mol. Its IUPAC name is [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate |
| PubChem CID | 146526462 |
| Molecular Formula | C12H10F2N2O4S |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cnc(Oc2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C12H10F2N2O4S/c1-21(17,18)19-7-8-5-16-11(6-15-8)20-12-9(13)3-2-4-10(12)14/h2-6H,7H2,1H3 |
| InChIKey | FEOXQCVJXVAVKC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate?
The IUPAC name of [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate (CID 146526462) is [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate.
What is the SMILES notation for [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate?
The canonical SMILES for [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate is CS(=O)(=O)OCc1cnc(Oc2c(F)cccc2F)cn1.
What is the InChIKey of [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate?
The InChIKey is FEOXQCVJXVAVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2O4S/c1-21(17,18)19-7-8-5-16-11(6-15-8)20-12-9(13)3-2-4-10(12)14/h2-6H,7H2,1H3.
What are the key properties of [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate?
[5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate has a molecular weight of 316.29 g/mol, XLogP of 2.02, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,6-difluorophenoxy)pyrazin-2-yl]methyl methanesulfonate is sourced from PubChem (CID 146526462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).