About N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine
N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine (PubChem CID 146526513) has the molecular formula C15H33NOS
and a molecular weight of 275.50 g/mol. Its IUPAC name is N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine |
| PubChem CID | 146526513 |
| Molecular Formula | C15H33NOS |
| Molecular Weight | 275.50 g/mol |
| Exact Mass | 275.23 |
| IUPAC Name | N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)CNCCSCCCOCC(C)(C)C |
| InChI | InChI=1S/C15H33NOS/c1-14(2,3)12-16-8-11-18-10-7-9-17-13-15(4,5)6/h16H,7-13H2,1-6H3 |
| InChIKey | ZEMLQZLHFIXYGW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine?
The IUPAC name of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine (CID 146526513) is N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine.
What is the SMILES notation for N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine?
The canonical SMILES for N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine is CC(C)(C)CNCCSCCCOCC(C)(C)C.
What is the InChIKey of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine?
The InChIKey is ZEMLQZLHFIXYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NOS/c1-14(2,3)12-16-8-11-18-10-7-9-17-13-15(4,5)6/h16H,7-13H2,1-6H3.
What are the key properties of N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine?
N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine has a molecular weight of 275.50 g/mol, XLogP of 3.81, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3-(2,2-dimethylpropoxy)propylsulfanyl]ethyl]-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 146526513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).