About 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate
3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate (PubChem CID 146526520) has the molecular formula C19H24N2O6
and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate.
Molecular Properties
| Compound Name | 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
| PubChem CID | 146526520 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate |
| SMILES | C=CCOCCCOC(=O)CCC(C(N)=O)N1Cc2c(O)cccc2C1=O |
| InChI | InChI=1S/C19H24N2O6/c1-2-9-26-10-4-11-27-17(23)8-7-15(18(20)24)21-12-14-13(19(21)25)5-3-6-16(14)22/h2-3,5-6,15,22H,1,4,7-12H2,(H2,20,24) |
| InChIKey | JKBYUDQSPXMFBT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
The IUPAC name of 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate (CID 146526520) is 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate.
What is the SMILES notation for 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
The canonical SMILES for 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate is C=CCOCCCOC(=O)CCC(C(N)=O)N1Cc2c(O)cccc2C1=O.
What is the InChIKey of 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
The InChIKey is JKBYUDQSPXMFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O6/c1-2-9-26-10-4-11-27-17(23)8-7-15(18(20)24)21-12-14-13(19(21)25)5-3-6-16(14)22/h2-3,5-6,15,22H,1,4,7-12H2,(H2,20,24).
What are the key properties of 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate?
3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate has a molecular weight of 376.41 g/mol, XLogP of 1.12, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoxypropyl 5-amino-4-(7-hydroxy-3-oxo-1H-isoindol-2-yl)-5-oxopentanoate is sourced from PubChem (CID 146526520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).