C12H21F3N2 — CID 146526665
(1R,2R)-1-N,1-N-dimethyl-2-N-propan-2-yl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine (PubChem CID 146526665) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (1R,2R)-1-N,1-N-dimethyl-2-N-propan-2-yl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine.
| Compound Name | (1R,2R)-1-N,1-N-dimethyl-2-N-propan-2-yl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine |
|---|---|
| PubChem CID | 146526665 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (1R,2R)-1-N,1-N-dimethyl-2-N-propan-2-yl-4-(trifluoromethyl)cyclohex-4-ene-1,2-diamine |
| SMILES | CC(C)N[C@@H]1CC(C(F)(F)F)=CC[C@H]1N(C)C |
| InChI | InChI=1S/C12H21F3N2/c1-8(2)16-10-7-9(12(13,14)15)5-6-11(10)17(3)4/h5,8,10-11,16H,6-7H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | FEPQFMAPUXQGJM-GHMZBOCLSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|