C27H29FIN5O5 — CID 146528032
N-[3-[5-(2-fluoro-4-iodoanilino)-2-hydroxy-3-(4-hydroxybutyl)-6,8-dimethyl-4,7-dioxo-2H-pyrido[4,3-d]pyrimidin-1-yl]phenyl]acetamide (PubChem CID 146528032) has the molecular formula C27H29FIN5O5 and a molecular weight of 649.46 g/mol. Its IUPAC name is N-[3-[5-(2-fluoro-4-iodoanilino)-2-hydroxy-3-(4-hydroxybutyl)-6,8-dimethyl-4,7-dioxo-2H-pyrido[4,3-d]pyrimidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-(2-fluoro-4-iodoanilino)-2-hydroxy-3-(4-hydroxybutyl)-6,8-dimethyl-4,7-dioxo-2H-pyrido[4,3-d]pyrimidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 146528032 |
| Molecular Formula | C27H29FIN5O5 |
| Molecular Weight | 649.46 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | N-[3-[5-(2-fluoro-4-iodoanilino)-2-hydroxy-3-(4-hydroxybutyl)-6,8-dimethyl-4,7-dioxo-2H-pyrido[4,3-d]pyrimidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(N2c3c(c(Nc4ccc(I)cc4F)n(C)c(=O)c3C)C(=O)N(CCCCO)C2O)c1 |
| InChI | InChI=1S/C27H29FIN5O5/c1-15-23-22(24(32(3)25(15)37)31-21-10-9-17(29)13-20(21)28)26(38)33(11-4-5-12-35)27(39)34(23)19-8-6-7-18(14-19)30-16(2)36/h6-10,13-14,27,31,35,39H,4-5,11-12H2,1-3H3,(H,30,36) |
| InChIKey | MOSGXQLZUIJDNE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|