C32H43NO6 — CID 14652841
[(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 14652841) has the molecular formula C32H43NO6 and a molecular weight of 537.70 g/mol. Its IUPAC name is [(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 14652841 |
| Molecular Formula | C32H43NO6 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | [(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@H](CNC(=O)c2ccccc2)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C32H43NO6/c1-5-32(3,4)31(37)39-27-16-21(19-33-30(36)22-9-7-6-8-10-22)15-23-12-11-20(2)26(29(23)27)14-13-25-17-24(34)18-28(35)38-25/h6-12,15,20-21,24-27,29,34H,5,13-14,16-19H2,1-4H3,(H,33,36)/t20-,21+,24+,25+,26-,27-,29-/m0/s1 |
| InChIKey | YYANCNYKGAUQJV-FLHYEDMUSA-N |
| XLogP | 5.00 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |