C31H41NO6 — CID 14652851
[(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 14652851) has the molecular formula C31H41NO6 and a molecular weight of 523.67 g/mol. Its IUPAC name is [(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 14652851 |
| Molecular Formula | C31H41NO6 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | [(1S,3S,7S,8S,8aR)-3-(benzamidomethyl)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H]1C[C@H](CNC(=O)c2ccccc2)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C31H41NO6/c1-4-19(2)31(36)38-27-15-21(18-32-30(35)22-8-6-5-7-9-22)14-23-11-10-20(3)26(29(23)27)13-12-25-16-24(33)17-28(34)37-25/h5-11,14,19-21,24-27,29,33H,4,12-13,15-18H2,1-3H3,(H,32,35)/t19?,20-,21+,24+,25+,26-,27-,29-/m0/s1 |
| InChIKey | CTVTYMANFSONGX-DCFGXOAESA-N |
| XLogP | 4.61 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |