C18H22FNO4 — CID 146529159
4-[(3E,5E)-4,6-dimethoxyhepta-1,3,5-trien-2-yl]-2-(1,3-dioxolan-2-yl)-5-fluoroaniline (PubChem CID 146529159) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 4-[(3E,5E)-4,6-dimethoxyhepta-1,3,5-trien-2-yl]-2-(1,3-dioxolan-2-yl)-5-fluoroaniline.
| Compound Name | 4-[(3E,5E)-4,6-dimethoxyhepta-1,3,5-trien-2-yl]-2-(1,3-dioxolan-2-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 146529159 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[(3E,5E)-4,6-dimethoxyhepta-1,3,5-trien-2-yl]-2-(1,3-dioxolan-2-yl)-5-fluoroaniline |
| SMILES | C=C(/C=C(\C=C(/C)OC)OC)c1cc(C2OCCO2)c(N)cc1F |
| InChI | InChI=1S/C18H22FNO4/c1-11(7-13(22-4)8-12(2)21-3)14-9-15(17(20)10-16(14)19)18-23-5-6-24-18/h7-10,18H,1,5-6,20H2,2-4H3/b12-8+,13-7+ |
| InChIKey | RIMJSRAHDZESCO-SWZPTJTJSA-N |
| XLogP | 3.55 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|