C19H29FN4O3 — CID 146529556
tert-butyl (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 146529556) has the molecular formula C19H29FN4O3 and a molecular weight of 380.46 g/mol. Its IUPAC name is tert-butyl (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146529556 |
| Molecular Formula | C19H29FN4O3 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | tert-butyl (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@@H](C)CN1C(C(=O)NN)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN4O3/c1-12-11-24(18(26)27-19(3,4)5)13(2)10-23(12)16(17(25)22-21)14-6-8-15(20)9-7-14/h6-9,12-13,16H,10-11,21H2,1-5H3,(H,22,25)/t12-,13+,16?/m1/s1 |
| InChIKey | ZNIXOHFKHLSFGY-IMSGDLLMSA-N |
| XLogP | 2.19 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|