C24H35FN4O4 — CID 146529648
tert-butyl (2S,5R)-4-[3-[(E)-[amino(cyclopropyl)methylidene]amino]oxy-1-(4-fluorophenyl)-3-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 146529648) has the molecular formula C24H35FN4O4 and a molecular weight of 462.57 g/mol. Its IUPAC name is tert-butyl (2S,5R)-4-[3-[(E)-[amino(cyclopropyl)methylidene]amino]oxy-1-(4-fluorophenyl)-3-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-4-[3-[(E)-[amino(cyclopropyl)methylidene]amino]oxy-1-(4-fluorophenyl)-3-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 146529648 |
| Molecular Formula | C24H35FN4O4 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | tert-butyl (2S,5R)-4-[3-[(E)-[amino(cyclopropyl)methylidene]amino]oxy-1-(4-fluorophenyl)-3-oxopropyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@@H](C)CN1C(CC(=O)O/N=C(/N)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H35FN4O4/c1-15-14-29(23(31)32-24(3,4)5)16(2)13-28(15)20(17-8-10-19(25)11-9-17)12-21(30)33-27-22(26)18-6-7-18/h8-11,15-16,18,20H,6-7,12-14H2,1-5H3,(H2,26,27)/t15-,16+,20?/m1/s1 |
| InChIKey | SGDGFZOIXYKKPI-BUWRGNEYSA-N |
| XLogP | 3.81 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|