C20H33IO4 — CID 146529722
(3R)-1-[(2S,5S)-5-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]-3-methylideneoxolan-2-yl]-6-iodohept-6-en-3-ol (PubChem CID 146529722) has the molecular formula C20H33IO4 and a molecular weight of 464.38 g/mol. Its IUPAC name is (3R)-1-[(2S,5S)-5-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]-3-methylideneoxolan-2-yl]-6-iodohept-6-en-3-ol.
| Compound Name | (3R)-1-[(2S,5S)-5-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]-3-methylideneoxolan-2-yl]-6-iodohept-6-en-3-ol |
|---|---|
| PubChem CID | 146529722 |
| Molecular Formula | C20H33IO4 |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (3R)-1-[(2S,5S)-5-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]-3-methylideneoxolan-2-yl]-6-iodohept-6-en-3-ol |
| SMILES | C=C(I)CC[C@H](O)CC[C@@H]1O[C@@H](CCC2OCC(C)(C)CO2)CC1=C |
| InChI | InChI=1S/C20H33IO4/c1-14-11-17(8-10-19-23-12-20(3,4)13-24-19)25-18(14)9-7-16(22)6-5-15(2)21/h16-19,22H,1-2,5-13H2,3-4H3/t16-,17-,18-/m0/s1 |
| InChIKey | PQJNXPKMKVAVGO-BZSNNMDCSA-N |
| XLogP | 4.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|