C23H22F3N5O — CID 146529846
8-[(2S)-2-ethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile (PubChem CID 146529846) has the molecular formula C23H22F3N5O and a molecular weight of 441.46 g/mol. Its IUPAC name is 8-[(2S)-2-ethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile.
| Compound Name | 8-[(2S)-2-ethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 146529846 |
| Molecular Formula | C23H22F3N5O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 8-[(2S)-2-ethyl-4-[(3,4,5-trifluorophenyl)methyl]piperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile |
| SMILES | CC[C@H]1CN(Cc2cc(F)c(F)c(F)c2)CCN1c1cc(=O)n(C)c2ccc(C#N)nc12 |
| InChI | InChI=1S/C23H22F3N5O/c1-3-16-13-30(12-14-8-17(24)22(26)18(25)9-14)6-7-31(16)20-10-21(32)29(2)19-5-4-15(11-27)28-23(19)20/h4-5,8-10,16H,3,6-7,12-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | RMBYESSWAPGFAW-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|