C14H16N2O2 — CID 146530020
(2R)-2-hydroxy-2-phenyl-1-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone (PubChem CID 146530020) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-phenyl-1-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone.
| Compound Name | (2R)-2-hydroxy-2-phenyl-1-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone |
|---|---|
| PubChem CID | 146530020 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2R)-2-hydroxy-2-phenyl-1-(2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethanone |
| SMILES | O=C([C@H](O)c1ccccc1)N1CC2=C(CNC2)C1 |
| InChI | InChI=1S/C14H16N2O2/c17-13(10-4-2-1-3-5-10)14(18)16-8-11-6-15-7-12(11)9-16/h1-5,13,15,17H,6-9H2/t13-/m1/s1 |
| InChIKey | BTGIKBSVYPIDAD-CYBMUJFWSA-N |
| XLogP | 0.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|