C23H23N3O4S — CID 146530143
5-(1-benzofuran-5-ylsulfonyl)-N-[(1R)-1-phenylethyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide (PubChem CID 146530143) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 5-(1-benzofuran-5-ylsulfonyl)-N-[(1R)-1-phenylethyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide.
| Compound Name | 5-(1-benzofuran-5-ylsulfonyl)-N-[(1R)-1-phenylethyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146530143 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 5-(1-benzofuran-5-ylsulfonyl)-N-[(1R)-1-phenylethyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3occc3c1)C2)c1ccccc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-16(17-5-3-2-4-6-17)24-23(27)25-12-19-14-26(15-20(19)13-25)31(28,29)21-7-8-22-18(11-21)9-10-30-22/h2-11,16H,12-15H2,1H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | UUQDJTGAPIQTGZ-MRXNPFEDSA-N |
| XLogP | 3.52 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|