C24H25F2N3O3S — CID 146530315
1-[5-[4-(difluoromethoxy)phenyl]sulfanyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)ethanone (PubChem CID 146530315) has the molecular formula C24H25F2N3O3S and a molecular weight of 473.55 g/mol. Its IUPAC name is 1-[5-[4-(difluoromethoxy)phenyl]sulfanyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)ethanone.
| Compound Name | 1-[5-[4-(difluoromethoxy)phenyl]sulfanyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)ethanone |
|---|---|
| PubChem CID | 146530315 |
| Molecular Formula | C24H25F2N3O3S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-[5-[4-(difluoromethoxy)phenyl]sulfanyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)ethanone |
| SMILES | CN1CCOc2ccc(CC(=O)N3CC4=C(CN(Sc5ccc(OC(F)F)cc5)C4)C3)cc21 |
| InChI | InChI=1S/C24H25F2N3O3S/c1-27-8-9-31-22-7-2-16(10-21(22)27)11-23(30)28-12-17-14-29(15-18(17)13-28)33-20-5-3-19(4-6-20)32-24(25)26/h2-7,10,24H,8-9,11-15H2,1H3 |
| InChIKey | UUFVIRKWEMRLPU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|