C11H13N3S — CID 146530431
5-pyridin-2-ylsulfanyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 146530431) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 5-pyridin-2-ylsulfanyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-pyridin-2-ylsulfanyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 146530431 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-pyridin-2-ylsulfanyl-2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | c1ccc(SN2CC3=C(CNC3)C2)nc1 |
| InChI | InChI=1S/C11H13N3S/c1-2-4-13-11(3-1)15-14-7-9-5-12-6-10(9)8-14/h1-4,12H,5-8H2 |
| InChIKey | SEIPIQXJHVPGJP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|