About 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide
4,4-dimethyl-2,3-dihydrochromene-8-carboxamide (PubChem CID 146530690) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide.
Molecular Properties
| Compound Name | 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide |
| PubChem CID | 146530690 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide |
| SMILES | CC1(C)CCOc2c(C(N)=O)cccc21 |
| InChI | InChI=1S/C12H15NO2/c1-12(2)6-7-15-10-8(11(13)14)4-3-5-9(10)12/h3-5H,6-7H2,1-2H3,(H2,13,14) |
| InChIKey | CPDZMXGBGNXMFK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide?
The IUPAC name of 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide (CID 146530690) is 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide.
What is the SMILES notation for 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide?
The canonical SMILES for 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide is CC1(C)CCOc2c(C(N)=O)cccc21.
What is the InChIKey of 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide?
The InChIKey is CPDZMXGBGNXMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-12(2)6-7-15-10-8(11(13)14)4-3-5-9(10)12/h3-5H,6-7H2,1-2H3,(H2,13,14).
What are the key properties of 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide?
4,4-dimethyl-2,3-dihydrochromene-8-carboxamide has a molecular weight of 205.26 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2,3-dihydrochromene-8-carboxamide is sourced from PubChem (CID 146530690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).