C29H38F3N7O2 — CID 146531066
1-[4-[7-(3-amino-2,5,6-trimethylphenyl)-2-[[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 146531066) has the molecular formula C29H38F3N7O2 and a molecular weight of 573.66 g/mol. Its IUPAC name is 1-[4-[7-(3-amino-2,5,6-trimethylphenyl)-2-[[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[4-[7-(3-amino-2,5,6-trimethylphenyl)-2-[[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 146531066 |
| Molecular Formula | C29H38F3N7O2 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 1-[4-[7-(3-amino-2,5,6-trimethylphenyl)-2-[[(2S)-4,4-difluoro-1-methylpyrrolidin-2-yl]methoxy]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OC[C@@H]3CC(F)(F)CN3C)nc3c2CCN(c2c(C)c(C)cc(N)c2C)C3)CC1 |
| InChI | InChI=1S/C29H38F3N7O2/c1-17-12-23(33)19(3)25(18(17)2)39-7-6-22-24(14-39)34-28(41-15-21-13-29(31,32)16-36(21)5)35-26(22)37-8-10-38(11-9-37)27(40)20(4)30/h12,21H,4,6-11,13-16,33H2,1-3,5H3/t21-/m0/s1 |
| InChIKey | VLKMDGFLIWPOPV-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|