C20H32O4 — CID 146531557
(2R,4R,6S)-6-[2-[(2S,5S)-5-[2-(1,3-dioxolan-2-yl)ethyl]-3-methylideneoxolan-2-yl]ethyl]-2,4-dimethyl-3-methylideneoxane (PubChem CID 146531557) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2R,4R,6S)-6-[2-[(2S,5S)-5-[2-(1,3-dioxolan-2-yl)ethyl]-3-methylideneoxolan-2-yl]ethyl]-2,4-dimethyl-3-methylideneoxane.
| Compound Name | (2R,4R,6S)-6-[2-[(2S,5S)-5-[2-(1,3-dioxolan-2-yl)ethyl]-3-methylideneoxolan-2-yl]ethyl]-2,4-dimethyl-3-methylideneoxane |
|---|---|
| PubChem CID | 146531557 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2R,4R,6S)-6-[2-[(2S,5S)-5-[2-(1,3-dioxolan-2-yl)ethyl]-3-methylideneoxolan-2-yl]ethyl]-2,4-dimethyl-3-methylideneoxane |
| SMILES | C=C1C[C@H](CCC2OCCO2)O[C@H]1CC[C@H]1C[C@@H](C)C(=C)[C@@H](C)O1 |
| InChI | InChI=1S/C20H32O4/c1-13-11-17(23-16(4)15(13)3)5-7-19-14(2)12-18(24-19)6-8-20-21-9-10-22-20/h13,16-20H,2-3,5-12H2,1,4H3/t13-,16-,17+,18+,19+/m1/s1 |
| InChIKey | WVDMZHDXAJWQGR-UVMNYOIOSA-N |
| XLogP | 4.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|