C16H25N3 — CID 146531765
(5Z,7Z)-1-[(2Z,4E)-hepta-2,4-dien-4-yl]-N,N-dimethyl-4,9-dihydro-1,3-diazonin-2-amine (PubChem CID 146531765) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (5Z,7Z)-1-[(2Z,4E)-hepta-2,4-dien-4-yl]-N,N-dimethyl-4,9-dihydro-1,3-diazonin-2-amine.
| Compound Name | (5Z,7Z)-1-[(2Z,4E)-hepta-2,4-dien-4-yl]-N,N-dimethyl-4,9-dihydro-1,3-diazonin-2-amine |
|---|---|
| PubChem CID | 146531765 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (5Z,7Z)-1-[(2Z,4E)-hepta-2,4-dien-4-yl]-N,N-dimethyl-4,9-dihydro-1,3-diazonin-2-amine |
| SMILES | C/C=C\C(=C/CC)N1C/C=C\C=C/C/N=C\1N(C)C |
| InChI | InChI=1S/C16H25N3/c1-5-11-15(12-6-2)19-14-10-8-7-9-13-17-16(19)18(3)4/h5,7-12H,6,13-14H2,1-4H3/b9-7-,10-8-,11-5-,15-12+,17-16- |
| InChIKey | VDTQDDQAIBPOKJ-QCZVWBFUSA-N |
| XLogP | 3.20 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|