C11H15N3 — CID 146531827
1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylimidazol-2-imine (PubChem CID 146531827) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylimidazol-2-imine.
| Compound Name | 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylimidazol-2-imine |
|---|---|
| PubChem CID | 146531827 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3-methylimidazol-2-imine |
| SMILES | [H]/N=c1\n(C)ccn1C(=C)/C=C\C=C/C |
| InChI | InChI=1S/C11H15N3/c1-4-5-6-7-10(2)14-9-8-13(3)11(14)12/h4-9,12H,2H2,1,3H3/b5-4-,7-6-,12-11+ |
| InChIKey | JWYHXQKKAZYYDE-QDFXUOAUSA-N |
| XLogP | 1.91 |
| TPSA | 33.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|