C12H19N3 — CID 146532026
1-cyclohepta-1,4,6-trien-1-yl-3-ethyl-1,2-dimethylguanidine (PubChem CID 146532026) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-yl-3-ethyl-1,2-dimethylguanidine.
| Compound Name | 1-cyclohepta-1,4,6-trien-1-yl-3-ethyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 146532026 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-yl-3-ethyl-1,2-dimethylguanidine |
| SMILES | CCN/C(=N\C)N(C)C1=CCC=CC=C1 |
| InChI | InChI=1S/C12H19N3/c1-4-14-12(13-2)15(3)11-9-7-5-6-8-10-11/h5-7,9-10H,4,8H2,1-3H3,(H,13,14) |
| InChIKey | UVNIONIFUHNNGP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|