C12H12I2O — CID 146532092
2,8-diiodo-1,2,3,4,4a,9b-hexahydrodibenzofuran (PubChem CID 146532092) has the molecular formula C12H12I2O and a molecular weight of 426.04 g/mol. Its IUPAC name is 2,8-diiodo-1,2,3,4,4a,9b-hexahydrodibenzofuran.
| Compound Name | 2,8-diiodo-1,2,3,4,4a,9b-hexahydrodibenzofuran |
|---|---|
| PubChem CID | 146532092 |
| Molecular Formula | C12H12I2O |
| Molecular Weight | 426.04 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | 2,8-diiodo-1,2,3,4,4a,9b-hexahydrodibenzofuran |
| SMILES | Ic1ccc2c(c1)C1CC(I)CCC1O2 |
| InChI | InChI=1S/C12H12I2O/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1,3,5,8,10,12H,2,4,6H2 |
| InChIKey | AZDYUZNCKZHRBP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.04 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|