C27H44O2 — CID 146532254
(3R,7aS)-2-methyl-3-[(Z)-2-methyl-3-methylidene-5-[4-methyl-2-(2-methylbutyl)-2,3-dihydrofuran-5-yl]hex-4-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 146532254) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (3R,7aS)-2-methyl-3-[(Z)-2-methyl-3-methylidene-5-[4-methyl-2-(2-methylbutyl)-2,3-dihydrofuran-5-yl]hex-4-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | (3R,7aS)-2-methyl-3-[(Z)-2-methyl-3-methylidene-5-[4-methyl-2-(2-methylbutyl)-2,3-dihydrofuran-5-yl]hex-4-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 146532254 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (3R,7aS)-2-methyl-3-[(Z)-2-methyl-3-methylidene-5-[4-methyl-2-(2-methylbutyl)-2,3-dihydrofuran-5-yl]hex-4-enyl]-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | C=C(/C=C(/C)C1=C(C)CC(CC(C)CC)O1)C(C)C[C@H]1C(C)O[C@H]2CCCCC12 |
| InChI | InChI=1S/C27H44O2/c1-8-17(2)13-23-15-21(6)27(29-23)20(5)14-18(3)19(4)16-25-22(7)28-26-12-10-9-11-24(25)26/h14,17,19,22-26H,3,8-13,15-16H2,1-2,4-7H3/b20-14-/t17?,19?,22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | JMENYMCPNRMVDP-MCJPXGTMSA-N |
| XLogP | 7.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|