C12H13N3 — CID 146532291
5-methyl-2,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,6,10,13-pentaene (PubChem CID 146532291) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 5-methyl-2,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,6,10,13-pentaene.
| Compound Name | 5-methyl-2,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,6,10,13-pentaene |
|---|---|
| PubChem CID | 146532291 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 5-methyl-2,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),3,6,10,13-pentaene |
| SMILES | CN1C=CN2C1=NCC1=C2C=CCC=C1 |
| InChI | InChI=1S/C12H13N3/c1-14-7-8-15-11-6-4-2-3-5-10(11)9-13-12(14)15/h3-8H,2,9H2,1H3 |
| InChIKey | SGONZWYDRZAOTC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |