C10H18N2 — CID 146532302
(1R,2S,6R,7S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 146532302) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,6R,7S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 146532302 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (1R,2S,6R,7S)-4,10-dimethyl-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | CN1C[C@@H]2[C@H](C1)[C@@H]1CC[C@H]2N1C |
| InChI | InChI=1S/C10H18N2/c1-11-5-7-8(6-11)10-4-3-9(7)12(10)2/h7-10H,3-6H2,1-2H3/t7-,8+,9-,10+ |
| InChIKey | LWHOQMUVPLFDHM-YNFQOJQRSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |